About (Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine
(Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine (PubChem CID 171105055) has the molecular formula C15H29N3
and a molecular weight of 251.42 g/mol. Its IUPAC name is (Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine |
| PubChem CID | 171105055 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | (Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine |
| SMILES | CC(N/C=C(\N)C1CCCCC1)C1CCNCC1 |
| InChI | InChI=1S/C15H29N3/c1-12(13-7-9-17-10-8-13)18-11-15(16)14-5-3-2-4-6-14/h11-14,17-18H,2-10,16H2,1H3/b15-11- |
| InChIKey | RTVDVGRYUMUGFH-PTNGSMBKSA-N |
| XLogP | 2.34 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine?
The IUPAC name of (Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine (CID 171105055) is (Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine.
What is the SMILES notation for (Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine?
The canonical SMILES for (Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine is CC(N/C=C(\N)C1CCCCC1)C1CCNCC1.
What is the InChIKey of (Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine?
The InChIKey is RTVDVGRYUMUGFH-PTNGSMBKSA-N. The full InChI is InChI=1S/C15H29N3/c1-12(13-7-9-17-10-8-13)18-11-15(16)14-5-3-2-4-6-14/h11-14,17-18H,2-10,16H2,1H3/b15-11-.
What are the key properties of (Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine?
(Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine has a molecular weight of 251.42 g/mol, XLogP of 2.34, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-cyclohexyl-N'-(1-piperidin-4-ylethyl)ethene-1,2-diamine is sourced from PubChem (CID 171105055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).