C9H17N3 — CID 144740222
(1Z)-1-piperidin-4-ylbuta-1,3-diene-1,3-diamine (PubChem CID 144740222) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (1Z)-1-piperidin-4-ylbuta-1,3-diene-1,3-diamine.
| Compound Name | (1Z)-1-piperidin-4-ylbuta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 144740222 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (1Z)-1-piperidin-4-ylbuta-1,3-diene-1,3-diamine |
| SMILES | C=C(N)/C=C(\N)C1CCNCC1 |
| InChI | InChI=1S/C9H17N3/c1-7(10)6-9(11)8-2-4-12-5-3-8/h6,8,12H,1-5,10-11H2/b9-6- |
| InChIKey | WSRAVWNORGAWFJ-TWGQIWQCSA-N |
| XLogP | 0.30 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|