About 1-ethynyl-4-methylcyclohexane;formaldehyde
1-ethynyl-4-methylcyclohexane;formaldehyde (PubChem CID 171105217) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-ethynyl-4-methylcyclohexane;formaldehyde.
Molecular Properties
| Compound Name | 1-ethynyl-4-methylcyclohexane;formaldehyde |
| PubChem CID | 171105217 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 1-ethynyl-4-methylcyclohexane;formaldehyde |
| SMILES | C#CC1CCC(C)CC1.C=O |
| InChI | InChI=1S/C9H14.CH2O/c1-3-9-6-4-8(2)5-7-9;1-2/h1,8-9H,4-7H2,2H3;1H2 |
| InChIKey | XAWCTOOLKHFLSM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynyl-4-methylcyclohexane;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynyl-4-methylcyclohexane;formaldehyde?
The IUPAC name of 1-ethynyl-4-methylcyclohexane;formaldehyde (CID 171105217) is 1-ethynyl-4-methylcyclohexane;formaldehyde.
What is the SMILES notation for 1-ethynyl-4-methylcyclohexane;formaldehyde?
The canonical SMILES for 1-ethynyl-4-methylcyclohexane;formaldehyde is C#CC1CCC(C)CC1.C=O.
What is the InChIKey of 1-ethynyl-4-methylcyclohexane;formaldehyde?
The InChIKey is XAWCTOOLKHFLSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14.CH2O/c1-3-9-6-4-8(2)5-7-9;1-2/h1,8-9H,4-7H2,2H3;1H2.
What are the key properties of 1-ethynyl-4-methylcyclohexane;formaldehyde?
1-ethynyl-4-methylcyclohexane;formaldehyde has a molecular weight of 152.24 g/mol, XLogP of 2.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynyl-4-methylcyclohexane;formaldehyde is sourced from PubChem (CID 171105217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).