C11H16 — CID 143198252
acetylene;cis-(1S,3R)-1-ethynyl-3-methylcyclohexane (PubChem CID 143198252) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is acetylene;cis-(1S,3R)-1-ethynyl-3-methylcyclohexane.
| Compound Name | acetylene;cis-(1S,3R)-1-ethynyl-3-methylcyclohexane |
|---|---|
| PubChem CID | 143198252 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | acetylene;cis-(1S,3R)-1-ethynyl-3-methylcyclohexane |
| SMILES | C#C.C#C[C@H]1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C9H14.C2H2/c1-3-9-6-4-5-8(2)7-9;1-2/h1,8-9H,4-7H2,2H3;1-2H/t8-,9+;/m1./s1 |
| InChIKey | YBKMJCDXEBIQKK-RJUBDTSPSA-N |
| XLogP | 2.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|