C9H12O — CID 45079260
cis-(1R,3S)-3-ethynylcyclohexane-1-carbaldehyde (PubChem CID 45079260) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is cis-(1R,3S)-3-ethynylcyclohexane-1-carbaldehyde.
| Compound Name | cis-(1R,3S)-3-ethynylcyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 45079260 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | cis-(1R,3S)-3-ethynylcyclohexane-1-carbaldehyde |
| SMILES | C#C[C@H]1CCC[C@@H](C=O)C1 |
| InChI | InChI=1S/C9H12O/c1-2-8-4-3-5-9(6-8)7-10/h1,7-9H,3-6H2/t8-,9+/m0/s1 |
| InChIKey | BELUCSIOMQCUII-DTWKUNHWSA-N |
| XLogP | 1.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|