C30H45N7O2S — CID 171105331
1-[2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-2-piperidin-4-ylacetyl]pyrrolidine-2-carbaldehyde;N-methyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine (PubChem CID 171105331) has the molecular formula C30H45N7O2S and a molecular weight of 567.80 g/mol. Its IUPAC name is 1-[2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-2-piperidin-4-ylacetyl]pyrrolidine-2-carbaldehyde;N-methyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine.
| Compound Name | 1-[2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-2-piperidin-4-ylacetyl]pyrrolidine-2-carbaldehyde;N-methyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 171105331 |
| Molecular Formula | C30H45N7O2S |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 567.34 |
| IUPAC Name | 1-[2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-2-piperidin-4-ylacetyl]pyrrolidine-2-carbaldehyde;N-methyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine |
| SMILES | CNC(C)c1ccc(-c2scnc2C)cc1.N/C(=C\N(N)C(C(=O)N1CCCC1C=O)C1CCNCC1)C1CC1 |
| InChI | InChI=1S/C17H29N5O2.C13H16N2S/c18-15(12-3-4-12)10-22(19)16(13-5-7-20-8-6-13)17(24)21-9-1-2-14(21)11-23;1-9(14-3)11-4-6-12(7-5-11)13-10(2)15-8-16-13/h10-14,16,20H,1-9,18-19H2;4-9,14H,1-3H3/b15-10-; |
| InChIKey | AILHDLPNXMDBFJ-AZJSCORLSA-N |
| XLogP | 3.33 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|