C28H46N6O2S — CID 171105064
2-[[(Z)-2-hydrazinylprop-1-enyl]amino]-3,3-dimethylbutanal;N-methyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine;1-methylpyrrolidine-2-carbaldehyde (PubChem CID 171105064) has the molecular formula C28H46N6O2S and a molecular weight of 530.78 g/mol. Its IUPAC name is 2-[[(Z)-2-hydrazinylprop-1-enyl]amino]-3,3-dimethylbutanal;N-methyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine;1-methylpyrrolidine-2-carbaldehyde.
| Compound Name | 2-[[(Z)-2-hydrazinylprop-1-enyl]amino]-3,3-dimethylbutanal;N-methyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine;1-methylpyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 171105064 |
| Molecular Formula | C28H46N6O2S |
| Molecular Weight | 530.78 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | 2-[[(Z)-2-hydrazinylprop-1-enyl]amino]-3,3-dimethylbutanal;N-methyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine;1-methylpyrrolidine-2-carbaldehyde |
| SMILES | C/C(=C/NC(C=O)C(C)(C)C)NN.CN1CCCC1C=O.CNC(C)c1ccc(-c2scnc2C)cc1 |
| InChI | InChI=1S/C13H16N2S.C9H19N3O.C6H11NO/c1-9(14-3)11-4-6-12(7-5-11)13-10(2)15-8-16-13;1-7(12-10)5-11-8(6-13)9(2,3)4;1-7-4-2-3-6(7)5-8/h4-9,14H,1-3H3;5-6,8,11-12H,10H2,1-4H3;5-6H,2-4H2,1H3/b;7-5-; |
| InChIKey | IAZJPMPAFANHKW-IQGCDTTGSA-N |
| XLogP | 4.19 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.78 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|