C17H16F2N4O3 — CID 171107884
N-[2-(3,3-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-formamidoquinoline-4-carboxamide (PubChem CID 171107884) has the molecular formula C17H16F2N4O3 and a molecular weight of 362.34 g/mol. Its IUPAC name is N-[2-(3,3-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-formamidoquinoline-4-carboxamide.
| Compound Name | N-[2-(3,3-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-formamidoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 171107884 |
| Molecular Formula | C17H16F2N4O3 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[2-(3,3-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-formamidoquinoline-4-carboxamide |
| SMILES | O=CNc1ccc2nccc(C(=O)NCC(=O)N3CCC(F)(F)C3)c2c1 |
| InChI | InChI=1S/C17H16F2N4O3/c18-17(19)4-6-23(9-17)15(25)8-21-16(26)12-3-5-20-14-2-1-11(22-10-24)7-13(12)14/h1-3,5,7,10H,4,6,8-9H2,(H,21,26)(H,22,24) |
| InChIKey | RIAIUPJAFKJWQV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|