C39H48CuF2N10O11-2 — CID 171107894
CID 171107894 (PubChem CID 171107894) has the molecular formula C39H48CuF2N10O11-2 and a molecular weight of 934.41 g/mol.
| Compound Name | CID 171107894 |
|---|---|
| PubChem CID | 171107894 |
| Molecular Formula | C39H48CuF2N10O11-2 |
| Molecular Weight | 934.41 g/mol |
| Exact Mass | 933.28 |
| IUPAC Name | — |
| SMILES | N#C[C@@H]1CC(F)(F)CN1C(=O)CNC(=O)c1ccnc2ccc(NC(=O)CCC(=O)NCCNC(=O)CCC(C(=O)O)N3CCN(CC(=O)O)CCN4CC(=O)O[C-]4C3)cc12.[CH3-].[Cu] |
| InChI | InChI=1S/C38H45F2N10O11.CH3.Cu/c39-38(40)16-24(17-41)50(22-38)32(54)18-45-36(58)25-7-8-42-27-2-1-23(15-26(25)27)46-31(53)6-5-30(52)44-10-9-43-29(51)4-3-28(37(59)60)48-13-11-47(20-34(55)56)12-14-49-21-35(57)61-33(49)19-48;;/h1-2,7-8,15,24,28H,3-6,9-14,16,18-22H2,(H,43,51)(H,44,52)(H,45,58)(H,46,53)(H,55,56)(H,59,60);1H3;/q2*-1;/t24-,28?;;/m0../s1 |
| InChIKey | ZZXGSIXEDCJNBO-PQLMVBIISA-N |
| XLogP | -0.59 |
| TPSA | 284.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.41 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|