C16H22N2O6S — CID 171108079
methyl 2-methyl-1-[2-(3-methylsulfonyloxypropoxy)ethyl]benzimidazole-4-carboxylate (PubChem CID 171108079) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is methyl 2-methyl-1-[2-(3-methylsulfonyloxypropoxy)ethyl]benzimidazole-4-carboxylate.
| Compound Name | methyl 2-methyl-1-[2-(3-methylsulfonyloxypropoxy)ethyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 171108079 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | methyl 2-methyl-1-[2-(3-methylsulfonyloxypropoxy)ethyl]benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2c1nc(C)n2CCOCCCOS(C)(=O)=O |
| InChI | InChI=1S/C16H22N2O6S/c1-12-17-15-13(16(19)22-2)6-4-7-14(15)18(12)8-11-23-9-5-10-24-25(3,20)21/h4,6-7H,5,8-11H2,1-3H3 |
| InChIKey | USYXKOWLDLJTIF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|