C18H32BFO2 — CID 171110468
2-[4-(3,3-dimethylcyclobutyl)-1-fluoro-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171110468) has the molecular formula C18H32BFO2 and a molecular weight of 310.26 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylcyclobutyl)-1-fluoro-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(3,3-dimethylcyclobutyl)-1-fluoro-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171110468 |
| Molecular Formula | C18H32BFO2 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 2-[4-(3,3-dimethylcyclobutyl)-1-fluoro-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C=C(F)B1OC(C)(C)C(C)(C)O1)CC1CC(C)(C)C1 |
| InChI | InChI=1S/C18H32BFO2/c1-15(2)9-13(10-15)11-16(3,4)12-14(20)19-21-17(5,6)18(7,8)22-19/h12-13H,9-11H2,1-8H3 |
| InChIKey | RBAGQOPCICJYFW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|