C18H33BO2 — CID 138981016
2-[1-(3,3-dipropylcyclobutyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 138981016) has the molecular formula C18H33BO2 and a molecular weight of 292.27 g/mol. Its IUPAC name is 2-[1-(3,3-dipropylcyclobutyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-(3,3-dipropylcyclobutyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 138981016 |
| Molecular Formula | C18H33BO2 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 2-[1-(3,3-dipropylcyclobutyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)C1CC(CCC)(CCC)C1 |
| InChI | InChI=1S/C18H33BO2/c1-8-10-18(11-9-2)12-15(13-18)14(3)19-20-16(4,5)17(6,7)21-19/h15H,3,8-13H2,1-2,4-7H3 |
| InChIKey | GUTFUGRITYISBW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|