C12H21BF2O2 — CID 171110564
2-(1,4-difluoro-3,3-dimethylbut-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171110564) has the molecular formula C12H21BF2O2 and a molecular weight of 246.11 g/mol. Its IUPAC name is 2-(1,4-difluoro-3,3-dimethylbut-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1,4-difluoro-3,3-dimethylbut-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171110564 |
| Molecular Formula | C12H21BF2O2 |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-(1,4-difluoro-3,3-dimethylbut-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C=C(F)B1OC(C)(C)C(C)(C)O1)CF |
| InChI | InChI=1S/C12H21BF2O2/c1-10(2,8-14)7-9(15)13-16-11(3,4)12(5,6)17-13/h7H,8H2,1-6H3 |
| InChIKey | CDEVVTVCEXLTNM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|