C14H17BFN3O2 — CID 171111239
2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 171111239) has the molecular formula C14H17BFN3O2 and a molecular weight of 289.12 g/mol. Its IUPAC name is 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 171111239 |
| Molecular Formula | C14H17BFN3O2 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CC1(C)OB(C(F)=Cc2nc3ccccn3n2)OC1(C)C |
| InChI | InChI=1S/C14H17BFN3O2/c1-13(2)14(3,4)21-15(20-13)10(16)9-11-17-12-7-5-6-8-19(12)18-11/h5-9H,1-4H3 |
| InChIKey | HQWYDUIOZRWYPN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|