C16H28BFO2 — CID 171112102
2-[fluoro-(3,3,5-trimethylcyclohexylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171112102) has the molecular formula C16H28BFO2 and a molecular weight of 282.21 g/mol. Its IUPAC name is 2-[fluoro-(3,3,5-trimethylcyclohexylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[fluoro-(3,3,5-trimethylcyclohexylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171112102 |
| Molecular Formula | C16H28BFO2 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2-[fluoro-(3,3,5-trimethylcyclohexylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1CC(=C(F)B2OC(C)(C)C(C)(C)O2)CC(C)(C)C1 |
| InChI | InChI=1S/C16H28BFO2/c1-11-8-12(10-14(2,3)9-11)13(18)17-19-15(4,5)16(6,7)20-17/h11H,8-10H2,1-7H3 |
| InChIKey | RUBHJMXPEUMHAW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|