C16H19BBrFN2O2 — CID 171112742
5-bromo-2-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 171112742) has the molecular formula C16H19BBrFN2O2 and a molecular weight of 381.05 g/mol. Its IUPAC name is 5-bromo-2-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-bromo-2-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 171112742 |
| Molecular Formula | C16H19BBrFN2O2 |
| Molecular Weight | 381.05 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 5-bromo-2-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC(=C(F)B1OC(C)(C)C(C)(C)O1)c1cc2cc(Br)cnc2[nH]1 |
| InChI | InChI=1S/C16H19BBrFN2O2/c1-9(12-7-10-6-11(18)8-20-14(10)21-12)13(19)17-22-15(2,3)16(4,5)23-17/h6-8H,1-5H3,(H,20,21) |
| InChIKey | OIGJZEXYXFBHGM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.05 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|