C18H21BBrFN2O2 — CID 171112754
5-bromo-2-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 171112754) has the molecular formula C18H21BBrFN2O2 and a molecular weight of 407.09 g/mol. Its IUPAC name is 5-bromo-2-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-bromo-2-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 171112754 |
| Molecular Formula | C18H21BBrFN2O2 |
| Molecular Weight | 407.09 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 5-bromo-2-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC1(C)OB(C(F)=C2CC(c3cc4cc(Br)cnc4[nH]3)C2)OC1(C)C |
| InChI | InChI=1S/C18H21BBrFN2O2/c1-17(2)18(3,4)25-19(24-17)15(21)11-5-10(6-11)14-8-12-7-13(20)9-22-16(12)23-14/h7-10H,5-6H2,1-4H3,(H,22,23)/b15-11- |
| InChIKey | WEJLASZNRFGYDI-PTNGSMBKSA-N |
| XLogP | 5.06 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.09 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|