C26H36BFN2O6 — CID 171113305
2-O-benzyl 5-O-tert-butyl 7-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,5-diazaspiro[3.4]octane-2,5-dicarboxylate (PubChem CID 171113305) has the molecular formula C26H36BFN2O6 and a molecular weight of 502.39 g/mol. Its IUPAC name is 2-O-benzyl 5-O-tert-butyl 7-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,5-diazaspiro[3.4]octane-2,5-dicarboxylate.
| Compound Name | 2-O-benzyl 5-O-tert-butyl 7-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,5-diazaspiro[3.4]octane-2,5-dicarboxylate |
|---|---|
| PubChem CID | 171113305 |
| Molecular Formula | C26H36BFN2O6 |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 2-O-benzyl 5-O-tert-butyl 7-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,5-diazaspiro[3.4]octane-2,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=C(F)B2OC(C)(C)C(C)(C)O2)CC12CN(C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C26H36BFN2O6/c1-23(2,3)34-22(32)30-14-19(20(28)27-35-24(4,5)25(6,7)36-27)13-26(30)16-29(17-26)21(31)33-15-18-11-9-8-10-12-18/h8-12H,13-17H2,1-7H3 |
| InChIKey | ZVHHJEKHOKBFCR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|