C18H31BFNO4 — CID 171113310
tert-butyl 4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 171113310) has the molecular formula C18H31BFNO4 and a molecular weight of 355.26 g/mol. Its IUPAC name is tert-butyl 4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171113310 |
| Molecular Formula | C18H31BFNO4 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | tert-butyl 4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=C(F)B2OC(C)(C)C(C)(C)O2)CC1(C)C |
| InChI | InChI=1S/C18H31BFNO4/c1-15(2,3)23-14(22)21-11-12(10-16(21,4)5)13(20)19-24-17(6,7)18(8,9)25-19/h10-11H2,1-9H3 |
| InChIKey | ZRIGYUCHFBTSJT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|