C15H25BFNO4 — CID 171114614
methyl 3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 171114614) has the molecular formula C15H25BFNO4 and a molecular weight of 313.18 g/mol. Its IUPAC name is methyl 3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | methyl 3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171114614 |
| Molecular Formula | C15H25BFNO4 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | methyl 3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(=C(F)B2OC(C)(C)C(C)(C)O2)C1(C)C |
| InChI | InChI=1S/C15H25BFNO4/c1-13(2)10(8-9-18(13)12(19)20-7)11(17)16-21-14(3,4)15(5,6)22-16/h8-9H2,1-7H3 |
| InChIKey | SQVQMPSZMGNPKF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|