C15H27BFNO2 — CID 171112005
4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-1-propylpiperidine (PubChem CID 171112005) has the molecular formula C15H27BFNO2 and a molecular weight of 283.20 g/mol. Its IUPAC name is 4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-1-propylpiperidine.
| Compound Name | 4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-1-propylpiperidine |
|---|---|
| PubChem CID | 171112005 |
| Molecular Formula | C15H27BFNO2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-1-propylpiperidine |
| SMILES | CCCN1CCC(=C(F)B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C15H27BFNO2/c1-6-9-18-10-7-12(8-11-18)13(17)16-19-14(2,3)15(4,5)20-16/h6-11H2,1-5H3 |
| InChIKey | RQZNVDVLISHVEO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|