C20H29BFNO2 — CID 171113364
1-benzyl-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-3-methylpiperidine (PubChem CID 171113364) has the molecular formula C20H29BFNO2 and a molecular weight of 345.27 g/mol. Its IUPAC name is 1-benzyl-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-3-methylpiperidine.
| Compound Name | 1-benzyl-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-3-methylpiperidine |
|---|---|
| PubChem CID | 171113364 |
| Molecular Formula | C20H29BFNO2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 1-benzyl-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-3-methylpiperidine |
| SMILES | CC1CN(Cc2ccccc2)CCC1=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H29BFNO2/c1-15-13-23(14-16-9-7-6-8-10-16)12-11-17(15)18(22)21-24-19(2,3)20(4,5)25-21/h6-10,15H,11-14H2,1-5H3 |
| InChIKey | YXVTYEFOMJDOAV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|