C19H29BFN3O4 — CID 171110226
tert-butyl 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (PubChem CID 171110226) has the molecular formula C19H29BFN3O4 and a molecular weight of 393.27 g/mol. Its IUPAC name is tert-butyl 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate.
| Compound Name | tert-butyl 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
|---|---|
| PubChem CID | 171110226 |
| Molecular Formula | C19H29BFN3O4 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | tert-butyl 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCn2nc(C=C(F)B3OC(C)(C)C(C)(C)O3)cc2C1 |
| InChI | InChI=1S/C19H29BFN3O4/c1-17(2,3)26-16(25)23-8-9-24-14(12-23)10-13(22-24)11-15(21)20-27-18(4,5)19(6,7)28-20/h10-11H,8-9,12H2,1-7H3 |
| InChIKey | IFXXMQRJLSXAGQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|