C24H37BN2O4S — CID 170804080
tert-butyl 4-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]piperazine-1-carboxylate (PubChem CID 170804080) has the molecular formula C24H37BN2O4S and a molecular weight of 460.45 g/mol. Its IUPAC name is tert-butyl 4-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170804080 |
| Molecular Formula | C24H37BN2O4S |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | tert-butyl 4-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C=C(CS)B3OC(C)(C)C(C)(C)O3)cc2)CC1 |
| InChI | InChI=1S/C24H37BN2O4S/c1-22(2,3)29-21(28)27-14-12-26(13-15-27)20-10-8-18(9-11-20)16-19(17-32)25-30-23(4,5)24(6,7)31-25/h8-11,16,32H,12-15,17H2,1-7H3 |
| InChIKey | KECVJRNKNNLEHL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 51.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|