C29H40BN3O5 — CID 66917501
tert-butyl 4-[4-[2-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethenyl]phenyl]piperazine-1-carboxylate (PubChem CID 66917501) has the molecular formula C29H40BN3O5 and a molecular weight of 521.47 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethenyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethenyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 66917501 |
| Molecular Formula | C29H40BN3O5 |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | tert-butyl 4-[4-[2-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethenyl]phenyl]piperazine-1-carboxylate |
| SMILES | COc1ncc(B2OC(C)(C)C(C)(C)O2)cc1C=Cc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C29H40BN3O5/c1-27(2,3)36-26(34)33-17-15-32(16-18-33)24-13-10-21(11-14-24)9-12-22-19-23(20-31-25(22)35-8)30-37-28(4,5)29(6,7)38-30/h9-14,19-20H,15-18H2,1-8H3 |
| InChIKey | QLKSLTGOZPAOBA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|