C25H40BN5O4 — CID 175911590
tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate;5-(4-methylpiperazin-1-yl)pyridin-2-amine (PubChem CID 175911590) has the molecular formula C25H40BN5O4 and a molecular weight of 485.44 g/mol. Its IUPAC name is tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate;5-(4-methylpiperazin-1-yl)pyridin-2-amine.
| Compound Name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate;5-(4-methylpiperazin-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 175911590 |
| Molecular Formula | C25H40BN5O4 |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.32 |
| IUPAC Name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate;5-(4-methylpiperazin-1-yl)pyridin-2-amine |
| SMILES | CC(C)(C)OC(=O)n1ccc(B2OC(C)(C)C(C)(C)O2)c1.CN1CCN(c2ccc(N)nc2)CC1 |
| InChI | InChI=1S/C15H24BNO4.C10H16N4/c1-13(2,3)19-12(18)17-9-8-11(10-17)16-20-14(4,5)15(6,7)21-16;1-13-4-6-14(7-5-13)9-2-3-10(11)12-8-9/h8-10H,1-7H3;2-3,8H,4-7H2,1H3,(H2,11,12) |
| InChIKey | QIJLKBFPUBFYBN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|