C21H24BFN2O2 — CID 171114137
1-[3-[4-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]phenyl]prop-2-ynyl]imidazole (PubChem CID 171114137) has the molecular formula C21H24BFN2O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 1-[3-[4-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]phenyl]prop-2-ynyl]imidazole.
| Compound Name | 1-[3-[4-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]phenyl]prop-2-ynyl]imidazole |
|---|---|
| PubChem CID | 171114137 |
| Molecular Formula | C21H24BFN2O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-[3-[4-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]phenyl]prop-2-ynyl]imidazole |
| SMILES | CC(=C(F)B1OC(C)(C)C(C)(C)O1)c1ccc(C#CCn2ccnc2)cc1 |
| InChI | InChI=1S/C21H24BFN2O2/c1-16(19(23)22-26-20(2,3)21(4,5)27-22)18-10-8-17(9-11-18)7-6-13-25-14-12-24-15-25/h8-12,14-15H,13H2,1-5H3 |
| InChIKey | BIDWTGZCXABJHT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|