C16H28BFO2 — CID 171114426
2-[fluoro-(2-propan-2-ylcyclohexylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171114426) has the molecular formula C16H28BFO2 and a molecular weight of 282.21 g/mol. Its IUPAC name is 2-[fluoro-(2-propan-2-ylcyclohexylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[fluoro-(2-propan-2-ylcyclohexylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171114426 |
| Molecular Formula | C16H28BFO2 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2-[fluoro-(2-propan-2-ylcyclohexylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)C1CCCCC1=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H28BFO2/c1-11(2)12-9-7-8-10-13(12)14(18)17-19-15(3,4)16(5,6)20-17/h11-12H,7-10H2,1-6H3 |
| InChIKey | MEZNWOFASNTNLM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|