C23H26FN3O3 — CID 171114944
4-anilino-1-[4-(4-fluorophenyl)-4-oxobutyl]-N-formylpiperidine-4-carboxamide (PubChem CID 171114944) has the molecular formula C23H26FN3O3 and a molecular weight of 411.48 g/mol. Its IUPAC name is 4-anilino-1-[4-(4-fluorophenyl)-4-oxobutyl]-N-formylpiperidine-4-carboxamide.
| Compound Name | 4-anilino-1-[4-(4-fluorophenyl)-4-oxobutyl]-N-formylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 171114944 |
| Molecular Formula | C23H26FN3O3 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 4-anilino-1-[4-(4-fluorophenyl)-4-oxobutyl]-N-formylpiperidine-4-carboxamide |
| SMILES | O=CNC(=O)C1(Nc2ccccc2)CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H26FN3O3/c24-19-10-8-18(9-11-19)21(29)7-4-14-27-15-12-23(13-16-27,22(30)25-17-28)26-20-5-2-1-3-6-20/h1-3,5-6,8-11,17,26H,4,7,12-16H2,(H,25,28,30) |
| InChIKey | TXBVZHFRYLMPJP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|