C19H28N3O8+ — CID 171115050
6-[1-(3-carboxypropyl)-4-pyridin-2-ylpiperazin-1-ium-1-yl]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 171115050) has the molecular formula C19H28N3O8+ and a molecular weight of 426.45 g/mol. Its IUPAC name is 6-[1-(3-carboxypropyl)-4-pyridin-2-ylpiperazin-1-ium-1-yl]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[1-(3-carboxypropyl)-4-pyridin-2-ylpiperazin-1-ium-1-yl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171115050 |
| Molecular Formula | C19H28N3O8+ |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 6-[1-(3-carboxypropyl)-4-pyridin-2-ylpiperazin-1-ium-1-yl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)CCC[N+]1(C2OC(C(=O)O)C(O)C(O)C2O)CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C19H27N3O8/c23-13(24)5-3-9-22(10-7-21(8-11-22)12-4-1-2-6-20-12)18-16(27)14(25)15(26)17(30-18)19(28)29/h1-2,4,6,14-18,25-27H,3,5,7-11H2,(H-,23,24,28,29)/p+1 |
| InChIKey | ZUDFDHOBQRPREA-UHFFFAOYSA-O |
| XLogP | -1.52 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|