C9H12N4 — CID 171115230
1,4,4a,5,6,7-hexahydroquinazolin-2-ylcyanamide (PubChem CID 171115230) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 1,4,4a,5,6,7-hexahydroquinazolin-2-ylcyanamide.
| Compound Name | 1,4,4a,5,6,7-hexahydroquinazolin-2-ylcyanamide |
|---|---|
| PubChem CID | 171115230 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1,4,4a,5,6,7-hexahydroquinazolin-2-ylcyanamide |
| SMILES | N#CNC1=NCC2CCCC=C2N1 |
| InChI | InChI=1S/C9H12N4/c10-6-12-9-11-5-7-3-1-2-4-8(7)13-9/h4,7H,1-3,5H2,(H2,11,12,13) |
| InChIKey | FKYLUNUMADWKDE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|