C11H11N3 — CID 176531881
1,3a,4,9b-tetrahydroperimidin-2-amine (PubChem CID 176531881) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 1,3a,4,9b-tetrahydroperimidin-2-amine.
| Compound Name | 1,3a,4,9b-tetrahydroperimidin-2-amine |
|---|---|
| PubChem CID | 176531881 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1,3a,4,9b-tetrahydroperimidin-2-amine |
| SMILES | NC1=NC2CC=C=C3C=CC=C(N1)C32 |
| InChI | InChI=1S/C11H11N3/c12-11-13-8-5-1-3-7-4-2-6-9(14-11)10(7)8/h1-3,5,9-10H,6H2,(H3,12,13,14) |
| InChIKey | AVQZRJPFBRCJCU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |