About 2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium
2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium (PubChem CID 171118088) has the molecular formula C12H11ClN2O5
and a molecular weight of 298.68 g/mol. Its IUPAC name is 2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium.
Molecular Properties
| Compound Name | 2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium |
| PubChem CID | 171118088 |
| Molecular Formula | C12H11ClN2O5 |
| Molecular Weight | 298.68 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium |
| SMILES | O=C([O-])c1cc([N+](=O)[O-])ccc1Cl.[NH3+]Cc1ccco1 |
| InChI | InChI=1S/C7H4ClNO4.C5H7NO/c8-6-2-1-4(9(12)13)3-5(6)7(10)11;6-4-5-2-1-3-7-5/h1-3H,(H,10,11);1-3H,4,6H2 |
| InChIKey | NMONMOGZWDZTAQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.68 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium?
The IUPAC name of 2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium (CID 171118088) is 2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium.
What is the SMILES notation for 2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium?
The canonical SMILES for 2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium is O=C([O-])c1cc([N+](=O)[O-])ccc1Cl.[NH3+]Cc1ccco1.
What is the InChIKey of 2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium?
The InChIKey is NMONMOGZWDZTAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClNO4.C5H7NO/c8-6-2-1-4(9(12)13)3-5(6)7(10)11;6-4-5-2-1-3-7-5/h1-3H,(H,10,11);1-3H,4,6H2.
What are the key properties of 2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium?
2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium has a molecular weight of 298.68 g/mol, XLogP of 0.63, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-nitrobenzoate;furan-2-ylmethylazanium is sourced from PubChem (CID 171118088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).