C21H26O5 — CID 171118575
methyl 2-[(1R,2R)-3-oxo-2-[(Z)-5-(2-phenylacetyl)oxypent-2-enyl]cyclopentyl]acetate (PubChem CID 171118575) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is methyl 2-[(1R,2R)-3-oxo-2-[(Z)-5-(2-phenylacetyl)oxypent-2-enyl]cyclopentyl]acetate.
| Compound Name | methyl 2-[(1R,2R)-3-oxo-2-[(Z)-5-(2-phenylacetyl)oxypent-2-enyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 171118575 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | methyl 2-[(1R,2R)-3-oxo-2-[(Z)-5-(2-phenylacetyl)oxypent-2-enyl]cyclopentyl]acetate |
| SMILES | COC(=O)C[C@H]1CCC(=O)[C@@H]1C/C=C\CCOC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H26O5/c1-25-20(23)15-17-11-12-19(22)18(17)10-6-3-7-13-26-21(24)14-16-8-4-2-5-9-16/h2-6,8-9,17-18H,7,10-15H2,1H3/b6-3-/t17-,18-/m1/s1 |
| InChIKey | NSICQIRZIQEYAD-GPGHGMIHSA-N |
| XLogP | 3.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|