C21H32O — CID 171120918
2-[(1R,3aS,5E,9E,12Z)-3a,6,10-trimethyl-2-methylidene-1,3,4,7,8,11-hexahydrocyclopenta[11]annulen-1-yl]propan-2-ol (PubChem CID 171120918) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is 2-[(1R,3aS,5E,9E,12Z)-3a,6,10-trimethyl-2-methylidene-1,3,4,7,8,11-hexahydrocyclopenta[11]annulen-1-yl]propan-2-ol.
| Compound Name | 2-[(1R,3aS,5E,9E,12Z)-3a,6,10-trimethyl-2-methylidene-1,3,4,7,8,11-hexahydrocyclopenta[11]annulen-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 171120918 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | 2-[(1R,3aS,5E,9E,12Z)-3a,6,10-trimethyl-2-methylidene-1,3,4,7,8,11-hexahydrocyclopenta[11]annulen-1-yl]propan-2-ol |
| SMILES | C=C1C[C@]2(C)C/C=C(\C)CC/C=C(\C)C/C=C\2[C@@H]1C(C)(C)O |
| InChI | InChI=1S/C21H32O/c1-15-8-7-9-16(2)12-13-21(6)14-17(3)19(20(4,5)22)18(21)11-10-15/h8,11-12,19,22H,3,7,9-10,13-14H2,1-2,4-6H3/b15-8+,16-12+,18-11-/t19-,21+/m1/s1 |
| InChIKey | ISJCQOQKSMBDJU-IXLYASROSA-N |
| XLogP | 5.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|