About 3-amino-5-cyclohexyl-N,N-diethylbenzamide
3-amino-5-cyclohexyl-N,N-diethylbenzamide (PubChem CID 171121587) has the molecular formula C17H26N2O
and a molecular weight of 274.41 g/mol. Its IUPAC name is 3-amino-5-cyclohexyl-N,N-diethylbenzamide.
Molecular Properties
| Compound Name | 3-amino-5-cyclohexyl-N,N-diethylbenzamide |
| PubChem CID | 171121587 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 3-amino-5-cyclohexyl-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(N)cc(C2CCCCC2)c1 |
| InChI | InChI=1S/C17H26N2O/c1-3-19(4-2)17(20)15-10-14(11-16(18)12-15)13-8-6-5-7-9-13/h10-13H,3-9,18H2,1-2H3 |
| InChIKey | AGWOMVRWPNUDTC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-cyclohexyl-N,N-diethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-cyclohexyl-N,N-diethylbenzamide?
The IUPAC name of 3-amino-5-cyclohexyl-N,N-diethylbenzamide (CID 171121587) is 3-amino-5-cyclohexyl-N,N-diethylbenzamide.
What is the SMILES notation for 3-amino-5-cyclohexyl-N,N-diethylbenzamide?
The canonical SMILES for 3-amino-5-cyclohexyl-N,N-diethylbenzamide is CCN(CC)C(=O)c1cc(N)cc(C2CCCCC2)c1.
What is the InChIKey of 3-amino-5-cyclohexyl-N,N-diethylbenzamide?
The InChIKey is AGWOMVRWPNUDTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O/c1-3-19(4-2)17(20)15-10-14(11-16(18)12-15)13-8-6-5-7-9-13/h10-13H,3-9,18H2,1-2H3.
What are the key properties of 3-amino-5-cyclohexyl-N,N-diethylbenzamide?
3-amino-5-cyclohexyl-N,N-diethylbenzamide has a molecular weight of 274.41 g/mol, XLogP of 3.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-cyclohexyl-N,N-diethylbenzamide is sourced from PubChem (CID 171121587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).