C15H14N2O3 — CID 171127268
methyl 2-[4-(3-oxo-1,2-dihydroinden-5-yl)pyrazol-1-yl]acetate (PubChem CID 171127268) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is methyl 2-[4-(3-oxo-1,2-dihydroinden-5-yl)pyrazol-1-yl]acetate.
| Compound Name | methyl 2-[4-(3-oxo-1,2-dihydroinden-5-yl)pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 171127268 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | methyl 2-[4-(3-oxo-1,2-dihydroinden-5-yl)pyrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(-c2ccc3c(c2)C(=O)CC3)cn1 |
| InChI | InChI=1S/C15H14N2O3/c1-20-15(19)9-17-8-12(7-16-17)11-3-2-10-4-5-14(18)13(10)6-11/h2-3,6-8H,4-5,9H2,1H3 |
| InChIKey | HPHXKYABDFDKSJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |