C23H18N4O2S — CID 171131444
9-methyl-13-[(5-phenyl-1H-pyrazol-4-yl)methylidene]-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one (PubChem CID 171131444) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is 9-methyl-13-[(5-phenyl-1H-pyrazol-4-yl)methylidene]-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one.
| Compound Name | 9-methyl-13-[(5-phenyl-1H-pyrazol-4-yl)methylidene]-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one |
|---|---|
| PubChem CID | 171131444 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 9-methyl-13-[(5-phenyl-1H-pyrazol-4-yl)methylidene]-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one |
| SMILES | CC12CC(c3ccccc3O1)n1c(sc(=Cc3cn[nH]c3-c3ccccc3)c1=O)=N2 |
| InChI | InChI=1S/C23H18N4O2S/c1-23-12-17(16-9-5-6-10-18(16)29-23)27-21(28)19(30-22(27)25-23)11-15-13-24-26-20(15)14-7-3-2-4-8-14/h2-11,13,17H,12H2,1H3,(H,24,26) |
| InChIKey | TVPVBGJMMZVKKU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |