C18H10FNO4S2 — CID 171132400
5-(1,3-benzodioxol-5-ylmethylidene)-3-(4-fluorobenzoyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 171132400) has the molecular formula C18H10FNO4S2 and a molecular weight of 387.41 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylidene)-3-(4-fluorobenzoyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylidene)-3-(4-fluorobenzoyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171132400 |
| Molecular Formula | C18H10FNO4S2 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylidene)-3-(4-fluorobenzoyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccc3c(c2)OCO3)SC(=S)N1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H10FNO4S2/c19-12-4-2-11(3-5-12)16(21)20-17(22)15(26-18(20)25)8-10-1-6-13-14(7-10)24-9-23-13/h1-8H,9H2 |
| InChIKey | ZJOYEKLXKGGGPZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|