C17H20N4O — CID 171134948
1-(2-pyridin-3-yl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)hex-3-en-1-one (PubChem CID 171134948) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-(2-pyridin-3-yl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)hex-3-en-1-one.
| Compound Name | 1-(2-pyridin-3-yl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)hex-3-en-1-one |
|---|---|
| PubChem CID | 171134948 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-(2-pyridin-3-yl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)hex-3-en-1-one |
| SMILES | CCC=CCC(=O)N1CCc2nc(-c3cccnc3)[nH]c2C1 |
| InChI | InChI=1S/C17H20N4O/c1-2-3-4-7-16(22)21-10-8-14-15(12-21)20-17(19-14)13-6-5-9-18-11-13/h3-6,9,11H,2,7-8,10,12H2,1H3,(H,19,20) |
| InChIKey | NSDFQSKMRMQKNU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|