C31H31N3O8S — CID 171135551
(9bR)-6-acetyl-7,9-dihydroxy-2-[1-[[1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-3-methylsulfanylpropyl]amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 171135551) has the molecular formula C31H31N3O8S and a molecular weight of 605.67 g/mol. Its IUPAC name is (9bR)-6-acetyl-7,9-dihydroxy-2-[1-[[1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-3-methylsulfanylpropyl]amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (9bR)-6-acetyl-7,9-dihydroxy-2-[1-[[1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-3-methylsulfanylpropyl]amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 171135551 |
| Molecular Formula | C31H31N3O8S |
| Molecular Weight | 605.67 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | (9bR)-6-acetyl-7,9-dihydroxy-2-[1-[[1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-3-methylsulfanylpropyl]amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | COc1ccc(-c2noc(C(CCSC)NC(C)=C3C(=O)C=C4Oc5c(C(C)=O)c(O)c(C)c(O)c5[C@@]4(C)C3=O)n2)cc1 |
| InChI | InChI=1S/C31H31N3O8S/c1-14-25(37)23(16(3)35)27-24(26(14)38)31(4)21(41-27)13-20(36)22(28(31)39)15(2)32-19(11-12-43-6)30-33-29(34-42-30)17-7-9-18(40-5)10-8-17/h7-10,13,19,32,37-38H,11-12H2,1-6H3/t19?,31-/m0/s1 |
| InChIKey | KIDRFIHRDBPFSW-CPHVJDLKSA-N |
| XLogP | 4.71 |
| TPSA | 161.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|