C14H17N3O3 — CID 120841371
methyl 4-[5-(3-aminobutan-2-yl)-1,2,4-oxadiazol-3-yl]benzoate (PubChem CID 120841371) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is methyl 4-[5-(3-aminobutan-2-yl)-1,2,4-oxadiazol-3-yl]benzoate.
| Compound Name | methyl 4-[5-(3-aminobutan-2-yl)-1,2,4-oxadiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 120841371 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | methyl 4-[5-(3-aminobutan-2-yl)-1,2,4-oxadiazol-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2noc(C(C)C(C)N)n2)cc1 |
| InChI | InChI=1S/C14H17N3O3/c1-8(9(2)15)13-16-12(17-20-13)10-4-6-11(7-5-10)14(18)19-3/h4-9H,15H2,1-3H3 |
| InChIKey | CLHBLCZPNZBMKP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |