C22H22N4O4 — CID 171138526
2-(2,4-dioxo-1H-quinazolin-3-yl)-3-(1H-indol-3-yl)-N-(2-methoxyethyl)propanamide (PubChem CID 171138526) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-(2,4-dioxo-1H-quinazolin-3-yl)-3-(1H-indol-3-yl)-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-(2,4-dioxo-1H-quinazolin-3-yl)-3-(1H-indol-3-yl)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 171138526 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-(2,4-dioxo-1H-quinazolin-3-yl)-3-(1H-indol-3-yl)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(Cc1c[nH]c2ccccc12)n1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C22H22N4O4/c1-30-11-10-23-20(27)19(12-14-13-24-17-8-4-2-6-15(14)17)26-21(28)16-7-3-5-9-18(16)25-22(26)29/h2-9,13,19,24H,10-12H2,1H3,(H,23,27)(H,25,29) |
| InChIKey | HZWBSNSHDRYDJX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|