C21H27FN2O4S — CID 171138774
4-(4-fluorophenoxy)-N-[3-(2-methylpropylsulfamoylmethyl)phenyl]butanamide (PubChem CID 171138774) has the molecular formula C21H27FN2O4S and a molecular weight of 422.52 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N-[3-(2-methylpropylsulfamoylmethyl)phenyl]butanamide.
| Compound Name | 4-(4-fluorophenoxy)-N-[3-(2-methylpropylsulfamoylmethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 171138774 |
| Molecular Formula | C21H27FN2O4S |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 4-(4-fluorophenoxy)-N-[3-(2-methylpropylsulfamoylmethyl)phenyl]butanamide |
| SMILES | CC(C)CNS(=O)(=O)Cc1cccc(NC(=O)CCCOc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H27FN2O4S/c1-16(2)14-23-29(26,27)15-17-5-3-6-19(13-17)24-21(25)7-4-12-28-20-10-8-18(22)9-11-20/h3,5-6,8-11,13,16,23H,4,7,12,14-15H2,1-2H3,(H,24,25) |
| InChIKey | RYNUJIXIWVBRRF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|