C21H25ClN4O3S — CID 91954178
3-(4-chloroindazol-1-yl)-N-[3-(2-methylpropylsulfamoylmethyl)phenyl]propanamide (PubChem CID 91954178) has the molecular formula C21H25ClN4O3S and a molecular weight of 448.98 g/mol. Its IUPAC name is 3-(4-chloroindazol-1-yl)-N-[3-(2-methylpropylsulfamoylmethyl)phenyl]propanamide.
| Compound Name | 3-(4-chloroindazol-1-yl)-N-[3-(2-methylpropylsulfamoylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 91954178 |
| Molecular Formula | C21H25ClN4O3S |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 3-(4-chloroindazol-1-yl)-N-[3-(2-methylpropylsulfamoylmethyl)phenyl]propanamide |
| SMILES | CC(C)CNS(=O)(=O)Cc1cccc(NC(=O)CCn2ncc3c(Cl)cccc32)c1 |
| InChI | InChI=1S/C21H25ClN4O3S/c1-15(2)12-24-30(28,29)14-16-5-3-6-17(11-16)25-21(27)9-10-26-20-8-4-7-19(22)18(20)13-23-26/h3-8,11,13,15,24H,9-10,12,14H2,1-2H3,(H,25,27) |
| InChIKey | ZVZZGFPQJUXLMU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |