C16H20ClN3O2 — CID 56686289
3-(4-chloroindazol-1-yl)-1-(2,6-dimethylmorpholin-4-yl)propan-1-one (PubChem CID 56686289) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 3-(4-chloroindazol-1-yl)-1-(2,6-dimethylmorpholin-4-yl)propan-1-one.
| Compound Name | 3-(4-chloroindazol-1-yl)-1-(2,6-dimethylmorpholin-4-yl)propan-1-one |
|---|---|
| PubChem CID | 56686289 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 3-(4-chloroindazol-1-yl)-1-(2,6-dimethylmorpholin-4-yl)propan-1-one |
| SMILES | CC1CN(C(=O)CCn2ncc3c(Cl)cccc32)CC(C)O1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-11-9-19(10-12(2)22-11)16(21)6-7-20-15-5-3-4-14(17)13(15)8-18-20/h3-5,8,11-12H,6-7,9-10H2,1-2H3 |
| InChIKey | UQHKFSZUYAGULD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |