C19H21N3O5S — CID 171138862
4-ethoxy-N-methyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfamoyl]benzamide (PubChem CID 171138862) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is 4-ethoxy-N-methyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfamoyl]benzamide.
| Compound Name | 4-ethoxy-N-methyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 171138862 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 4-ethoxy-N-methyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfamoyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC)cc1S(=O)(=O)Nc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C19H21N3O5S/c1-3-27-16-8-4-13(19(24)20-2)11-17(16)28(25,26)22-14-6-7-15-12(10-14)5-9-18(23)21-15/h4,6-8,10-11,22H,3,5,9H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | ZFQCRNJJSSPXTE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |