C17H16ClNO3S — CID 171139322
1-(7-chloro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-en-1-one (PubChem CID 171139322) has the molecular formula C17H16ClNO3S and a molecular weight of 349.84 g/mol. Its IUPAC name is 1-(7-chloro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-en-1-one.
| Compound Name | 1-(7-chloro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171139322 |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 1-(7-chloro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(CO)cs1)N1CCOc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C17H16ClNO3S/c18-14-1-3-16-13(8-14)9-19(5-6-22-16)17(21)4-2-15-7-12(10-20)11-23-15/h1-4,7-8,11,20H,5-6,9-10H2 |
| InChIKey | YLEJFUZASAHJKV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|