C22H30N2O2S — CID 171139730
1-[4-(2-adamantyl)piperazin-1-yl]-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-en-1-one (PubChem CID 171139730) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is 1-[4-(2-adamantyl)piperazin-1-yl]-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-en-1-one.
| Compound Name | 1-[4-(2-adamantyl)piperazin-1-yl]-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171139730 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-[4-(2-adamantyl)piperazin-1-yl]-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(CO)cs1)N1CCN(C2C3CC4CC(C3)CC2C4)CC1 |
| InChI | InChI=1S/C22H30N2O2S/c25-13-17-12-20(27-14-17)1-2-21(26)23-3-5-24(6-4-23)22-18-8-15-7-16(10-18)11-19(22)9-15/h1-2,12,14-16,18-19,22,25H,3-11,13H2 |
| InChIKey | BGBXCZMWDPSGTE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|