C21H19N3O5S — CID 171140103
5-(furan-2-ylmethylidene)-3-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 171140103) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is 5-(furan-2-ylmethylidene)-3-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(furan-2-ylmethylidene)-3-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 171140103 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 5-(furan-2-ylmethylidene)-3-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)SC(=Cc2ccco2)C1=O)N1C[C@H]2C[C@@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C21H19N3O5S/c25-18-5-1-4-16-14-7-13(10-23(16)18)9-22(11-14)19(26)12-24-20(27)17(30-21(24)28)8-15-3-2-6-29-15/h1-6,8,13-14H,7,9-12H2/t13-,14+/m1/s1 |
| InChIKey | VETIPRLHUXVWSV-KGLIPLIRSA-N |
| XLogP | 2.12 |
| TPSA | 92.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|